C17H13F13O3 — CID 162347733
benzyl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-hydroxy-2-methylnonanoate (PubChem CID 162347733) has the molecular formula C17H13F13O3 and a molecular weight of 512.26 g/mol. Its IUPAC name is benzyl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-hydroxy-2-methylnonanoate.
| Compound Name | benzyl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-hydroxy-2-methylnonanoate |
|---|---|
| PubChem CID | 162347733 |
| Molecular Formula | C17H13F13O3 |
| Molecular Weight | 512.26 g/mol |
| Exact Mass | 512.07 |
| IUPAC Name | benzyl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-hydroxy-2-methylnonanoate |
| SMILES | CC(O)(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H13F13O3/c1-11(32,10(31)33-7-9-5-3-2-4-6-9)8-12(18,19)13(20,21)14(22,23)15(24,25)16(26,27)17(28,29)30/h2-6,32H,7-8H2,1H3 |
| InChIKey | WUMOBXQSRIRYBM-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.26 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|