C11H10F11NO2 — CID 162347879
2-hydroxy-N,N-dimethyl-3-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)propanamide (PubChem CID 162347879) has the molecular formula C11H10F11NO2 and a molecular weight of 397.18 g/mol. Its IUPAC name is 2-hydroxy-N,N-dimethyl-3-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)propanamide.
| Compound Name | 2-hydroxy-N,N-dimethyl-3-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)propanamide |
|---|---|
| PubChem CID | 162347879 |
| Molecular Formula | C11H10F11NO2 |
| Molecular Weight | 397.18 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | 2-hydroxy-N,N-dimethyl-3-(1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexyl)propanamide |
| SMILES | CN(C)C(=O)C(O)CC1(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C11H10F11NO2/c1-23(2)5(25)4(24)3-6(12)7(13,14)9(17,18)11(21,22)10(19,20)8(6,15)16/h4,24H,3H2,1-2H3 |
| InChIKey | VRXCVEPTLWXHGT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.18 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|