C19H17F13O3 — CID 162347902
ethyl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-hydroxy-2-(2-phenylethyl)nonanoate (PubChem CID 162347902) has the molecular formula C19H17F13O3 and a molecular weight of 540.32 g/mol. Its IUPAC name is ethyl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-hydroxy-2-(2-phenylethyl)nonanoate.
| Compound Name | ethyl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-hydroxy-2-(2-phenylethyl)nonanoate |
|---|---|
| PubChem CID | 162347902 |
| Molecular Formula | C19H17F13O3 |
| Molecular Weight | 540.32 g/mol |
| Exact Mass | 540.10 |
| IUPAC Name | ethyl 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-hydroxy-2-(2-phenylethyl)nonanoate |
| SMILES | CCOC(=O)C(O)(CCc1ccccc1)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H17F13O3/c1-2-35-12(33)13(34,9-8-11-6-4-3-5-7-11)10-14(20,21)15(22,23)16(24,25)17(26,27)18(28,29)19(30,31)32/h3-7,34H,2,8-10H2,1H3 |
| InChIKey | PPKYFMLJOGNGCM-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.32 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|