C10H12F9NO2 — CID 162348275
4,5,5,6,6,6-hexafluoro-2-hydroxy-N,N,2-trimethyl-4-(trifluoromethyl)hexanamide (PubChem CID 162348275) has the molecular formula C10H12F9NO2 and a molecular weight of 349.19 g/mol. Its IUPAC name is 4,5,5,6,6,6-hexafluoro-2-hydroxy-N,N,2-trimethyl-4-(trifluoromethyl)hexanamide.
| Compound Name | 4,5,5,6,6,6-hexafluoro-2-hydroxy-N,N,2-trimethyl-4-(trifluoromethyl)hexanamide |
|---|---|
| PubChem CID | 162348275 |
| Molecular Formula | C10H12F9NO2 |
| Molecular Weight | 349.19 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 4,5,5,6,6,6-hexafluoro-2-hydroxy-N,N,2-trimethyl-4-(trifluoromethyl)hexanamide |
| SMILES | CN(C)C(=O)C(C)(O)CC(F)(C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H12F9NO2/c1-6(22,5(21)20(2)3)4-7(11,9(14,15)16)8(12,13)10(17,18)19/h22H,4H2,1-3H3 |
| InChIKey | XJHQZASDTBCWEA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.19 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|