C11H10F13NO2 — CID 162348350
4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-hydroxy-N,N-dimethylnonanamide (PubChem CID 162348350) has the molecular formula C11H10F13NO2 and a molecular weight of 435.18 g/mol. Its IUPAC name is 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-hydroxy-N,N-dimethylnonanamide.
| Compound Name | 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-hydroxy-N,N-dimethylnonanamide |
|---|---|
| PubChem CID | 162348350 |
| Molecular Formula | C11H10F13NO2 |
| Molecular Weight | 435.18 g/mol |
| Exact Mass | 435.05 |
| IUPAC Name | 4,4,5,5,6,6,7,7,8,8,9,9,9-tridecafluoro-2-hydroxy-N,N-dimethylnonanamide |
| SMILES | CN(C)C(=O)C(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H10F13NO2/c1-25(2)5(27)4(26)3-6(12,13)7(14,15)8(16,17)9(18,19)10(20,21)11(22,23)24/h4,26H,3H2,1-2H3 |
| InChIKey | AKOZNQJCMKNCNZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.18 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|