C10H10F9NO2 — CID 162348488
2-hydroxy-N,N-dimethyl-3-(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl)propanamide (PubChem CID 162348488) has the molecular formula C10H10F9NO2 and a molecular weight of 347.18 g/mol. Its IUPAC name is 2-hydroxy-N,N-dimethyl-3-(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl)propanamide.
| Compound Name | 2-hydroxy-N,N-dimethyl-3-(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl)propanamide |
|---|---|
| PubChem CID | 162348488 |
| Molecular Formula | C10H10F9NO2 |
| Molecular Weight | 347.18 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 2-hydroxy-N,N-dimethyl-3-(1,2,2,3,3,4,4,5,5-nonafluorocyclopentyl)propanamide |
| SMILES | CN(C)C(=O)C(O)CC1(F)C(F)(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C10H10F9NO2/c1-20(2)5(22)4(21)3-6(11)7(12,13)9(16,17)10(18,19)8(6,14)15/h4,21H,3H2,1-2H3 |
| InChIKey | DYDXTKNWVFOGRN-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.18 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|