C8H11N5 — CID 162349466
2-(azidomethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine (PubChem CID 162349466) has the molecular formula C8H11N5 and a molecular weight of 177.21 g/mol. Its IUPAC name is 2-(azidomethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine.
| Compound Name | 2-(azidomethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 162349466 |
| Molecular Formula | C8H11N5 |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 2-(azidomethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyridine |
| SMILES | [N-]=[N+]=NCc1cc2n(n1)CCCC2 |
| InChI | InChI=1S/C8H11N5/c9-12-10-6-7-5-8-3-1-2-4-13(8)11-7/h5H,1-4,6H2 |
| InChIKey | KXOBGFQRAHACDY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 66.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|