C18H22F3N3O2 — CID 162349517
1-[3-(2-methylquinazolin-4-yl)oxypropyl]-4-(trifluoromethyl)piperidin-4-ol (PubChem CID 162349517) has the molecular formula C18H22F3N3O2 and a molecular weight of 369.39 g/mol. Its IUPAC name is 1-[3-(2-methylquinazolin-4-yl)oxypropyl]-4-(trifluoromethyl)piperidin-4-ol.
| Compound Name | 1-[3-(2-methylquinazolin-4-yl)oxypropyl]-4-(trifluoromethyl)piperidin-4-ol |
|---|---|
| PubChem CID | 162349517 |
| Molecular Formula | C18H22F3N3O2 |
| Molecular Weight | 369.39 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 1-[3-(2-methylquinazolin-4-yl)oxypropyl]-4-(trifluoromethyl)piperidin-4-ol |
| SMILES | Cc1nc(OCCCN2CCC(O)(C(F)(F)F)CC2)c2ccccc2n1 |
| InChI | InChI=1S/C18H22F3N3O2/c1-13-22-15-6-3-2-5-14(15)16(23-13)26-12-4-9-24-10-7-17(25,8-11-24)18(19,20)21/h2-3,5-6,25H,4,7-12H2,1H3 |
| InChIKey | GZQKXJCLPDCFGO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|