C22H26FNO2S — CID 162349532
(7S,7aS)-7-(4-fluoro-3-methylphenyl)-1-(1-methylcyclohexa-2,4-dien-1-yl)sulfonyl-2,3,5,6,7,7a-hexahydroindole (PubChem CID 162349532) has the molecular formula C22H26FNO2S and a molecular weight of 387.52 g/mol. Its IUPAC name is (7S,7aS)-7-(4-fluoro-3-methylphenyl)-1-(1-methylcyclohexa-2,4-dien-1-yl)sulfonyl-2,3,5,6,7,7a-hexahydroindole.
| Compound Name | (7S,7aS)-7-(4-fluoro-3-methylphenyl)-1-(1-methylcyclohexa-2,4-dien-1-yl)sulfonyl-2,3,5,6,7,7a-hexahydroindole |
|---|---|
| PubChem CID | 162349532 |
| Molecular Formula | C22H26FNO2S |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | (7S,7aS)-7-(4-fluoro-3-methylphenyl)-1-(1-methylcyclohexa-2,4-dien-1-yl)sulfonyl-2,3,5,6,7,7a-hexahydroindole |
| SMILES | Cc1cc([C@@H]2CCC=C3CCN(S(=O)(=O)C4(C)C=CC=CC4)[C@H]32)ccc1F |
| InChI | InChI=1S/C22H26FNO2S/c1-16-15-18(9-10-20(16)23)19-8-6-7-17-11-14-24(21(17)19)27(25,26)22(2)12-4-3-5-13-22/h3-5,7,9-10,12,15,19,21H,6,8,11,13-14H2,1-2H3/t19-,21+,22?/m0/s1 |
| InChIKey | SYLOJXIXCJVZTL-BMHUVXDISA-N |
| XLogP | 4.62 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|