About 4-[[(1R,5S)-1-tert-butyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-2-fluorobenzaldehyde
4-[[(1R,5S)-1-tert-butyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-2-fluorobenzaldehyde (PubChem CID 162350164) has the molecular formula C18H24FNO2
and a molecular weight of 305.39 g/mol. Its IUPAC name is 4-[[(1R,5S)-1-tert-butyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-2-fluorobenzaldehyde.
Molecular Properties
| Compound Name | 4-[[(1R,5S)-1-tert-butyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-2-fluorobenzaldehyde |
| PubChem CID | 162350164 |
| Molecular Formula | C18H24FNO2 |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | 4-[[(1R,5S)-1-tert-butyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-2-fluorobenzaldehyde |
| SMILES | CC(C)(C)[C@@]12CC[C@@H](CC(Oc3ccc(C=O)c(F)c3)C1)N2 |
| InChI | InChI=1S/C18H24FNO2/c1-17(2,3)18-7-6-13(20-18)8-15(10-18)22-14-5-4-12(11-21)16(19)9-14/h4-5,9,11,13,15,20H,6-8,10H2,1-3H3/t13-,15?,18+/m0/s1 |
| InChIKey | PDOQISHAZPDRPC-PLXAZLAVSA-N |
| XLogP | 3.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(1R,5S)-1-tert-butyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-2-fluorobenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(1R,5S)-1-tert-butyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-2-fluorobenzaldehyde?
The IUPAC name of 4-[[(1R,5S)-1-tert-butyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-2-fluorobenzaldehyde (CID 162350164) is 4-[[(1R,5S)-1-tert-butyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-2-fluorobenzaldehyde.
What is the SMILES notation for 4-[[(1R,5S)-1-tert-butyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-2-fluorobenzaldehyde?
The canonical SMILES for 4-[[(1R,5S)-1-tert-butyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-2-fluorobenzaldehyde is CC(C)(C)[C@@]12CC[C@@H](CC(Oc3ccc(C=O)c(F)c3)C1)N2.
What is the InChIKey of 4-[[(1R,5S)-1-tert-butyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-2-fluorobenzaldehyde?
The InChIKey is PDOQISHAZPDRPC-PLXAZLAVSA-N. The full InChI is InChI=1S/C18H24FNO2/c1-17(2,3)18-7-6-13(20-18)8-15(10-18)22-14-5-4-12(11-21)16(19)9-14/h4-5,9,11,13,15,20H,6-8,10H2,1-3H3/t13-,15?,18+/m0/s1.
What are the key properties of 4-[[(1R,5S)-1-tert-butyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-2-fluorobenzaldehyde?
4-[[(1R,5S)-1-tert-butyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-2-fluorobenzaldehyde has a molecular weight of 305.39 g/mol, XLogP of 3.72, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(1R,5S)-1-tert-butyl-8-azabicyclo[3.2.1]octan-3-yl]oxy]-2-fluorobenzaldehyde is sourced from PubChem (CID 162350164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).