N,N-bis(2-methoxyethyl)sulfamoyl fluoride

C6H14FNO4S — CID 162350170

IUPACN,N-bis(2-methoxyethyl)sulfamoyl fluoride
SMILESCOCCN(CCOC)S(=O)(=O)F
InChIInChI=1S/C6H14FNO4S/c1-11-5-3-8(4-6-12-2)13(7,9)10/h3-6H2,1-2H3
InChIKeyVHFLWYLDKRAMLL-UHFFFAOYSA-N
MW215.25 g/mol
LogP-0.20
Rot. Bonds7

About N,N-bis(2-methoxyethyl)sulfamoyl fluoride

N,N-bis(2-methoxyethyl)sulfamoyl fluoride (PubChem CID 162350170) has the molecular formula C6H14FNO4S and a molecular weight of 215.25 g/mol. Its IUPAC name is N,N-bis(2-methoxyethyl)sulfamoyl fluoride.

Molecular Properties

Compound NameN,N-bis(2-methoxyethyl)sulfamoyl fluoride
PubChem CID162350170
Molecular FormulaC6H14FNO4S
Molecular Weight215.25 g/mol
Exact Mass215.06
IUPAC NameN,N-bis(2-methoxyethyl)sulfamoyl fluoride
SMILESCOCCN(CCOC)S(=O)(=O)F
InChIInChI=1S/C6H14FNO4S/c1-11-5-3-8(4-6-12-2)13(7,9)10/h3-6H2,1-2H3
InChIKeyVHFLWYLDKRAMLL-UHFFFAOYSA-N
XLogP-0.20
TPSA55.84 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.25
LogP ≤ 5-0.20
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze N,N-bis(2-methoxyethyl)sulfamoyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N,N-bis(2-methoxyethyl)sulfamoyl fluoride?
The IUPAC name of N,N-bis(2-methoxyethyl)sulfamoyl fluoride (CID 162350170) is N,N-bis(2-methoxyethyl)sulfamoyl fluoride.
What is the SMILES notation for N,N-bis(2-methoxyethyl)sulfamoyl fluoride?
The canonical SMILES for N,N-bis(2-methoxyethyl)sulfamoyl fluoride is COCCN(CCOC)S(=O)(=O)F.
What is the InChIKey of N,N-bis(2-methoxyethyl)sulfamoyl fluoride?
The InChIKey is VHFLWYLDKRAMLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14FNO4S/c1-11-5-3-8(4-6-12-2)13(7,9)10/h3-6H2,1-2H3.
What are the key properties of N,N-bis(2-methoxyethyl)sulfamoyl fluoride?
N,N-bis(2-methoxyethyl)sulfamoyl fluoride has a molecular weight of 215.25 g/mol, XLogP of -0.20, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(2-methoxyethyl)sulfamoyl fluoride is sourced from PubChem (CID 162350170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).