C14H26N2O4 — CID 162350227
[(E)-4-carbamoyloxybut-2-enyl] N,N-ditert-butylcarbamate (PubChem CID 162350227) has the molecular formula C14H26N2O4 and a molecular weight of 286.37 g/mol. Its IUPAC name is [(E)-4-carbamoyloxybut-2-enyl] N,N-ditert-butylcarbamate.
| Compound Name | [(E)-4-carbamoyloxybut-2-enyl] N,N-ditert-butylcarbamate |
|---|---|
| PubChem CID | 162350227 |
| Molecular Formula | C14H26N2O4 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | [(E)-4-carbamoyloxybut-2-enyl] N,N-ditert-butylcarbamate |
| SMILES | CC(C)(C)N(C(=O)OC/C=C/COC(N)=O)C(C)(C)C |
| InChI | InChI=1S/C14H26N2O4/c1-13(2,3)16(14(4,5)6)12(18)20-10-8-7-9-19-11(15)17/h7-8H,9-10H2,1-6H3,(H2,15,17)/b8-7+ |
| InChIKey | PSNXGEBTJCQLON-BQYQJAHWSA-N |
| XLogP | 2.67 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|