C30H54O5 — CID 162350669
11-butoxy-11-(1-butoxy-11-oxoundec-2-enoxy)undec-9-enal (PubChem CID 162350669) has the molecular formula C30H54O5 and a molecular weight of 494.76 g/mol. Its IUPAC name is 11-butoxy-11-(1-butoxy-11-oxoundec-2-enoxy)undec-9-enal.
| Compound Name | 11-butoxy-11-(1-butoxy-11-oxoundec-2-enoxy)undec-9-enal |
|---|---|
| PubChem CID | 162350669 |
| Molecular Formula | C30H54O5 |
| Molecular Weight | 494.76 g/mol |
| Exact Mass | 494.40 |
| IUPAC Name | 11-butoxy-11-(1-butoxy-11-oxoundec-2-enoxy)undec-9-enal |
| SMILES | CCCCOC(C=CCCCCCCCC=O)OC(C=CCCCCCCCC=O)OCCCC |
| InChI | InChI=1S/C30H54O5/c1-3-5-27-33-29(23-19-15-11-7-9-13-17-21-25-31)35-30(34-28-6-4-2)24-20-16-12-8-10-14-18-22-26-32/h19-20,23-26,29-30H,3-18,21-22,27-28H2,1-2H3 |
| InChIKey | FXBZGJFBOFARJX-UHFFFAOYSA-N |
| XLogP | 8.26 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.76 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|