C13H11FN2O5S — CID 162350768
2-acetyl-7-fluoro-1'-methyl-1,1-dioxospiro[1,2-benzothiazole-3,3'-pyrrolidine]-2',5'-dione (PubChem CID 162350768) has the molecular formula C13H11FN2O5S and a molecular weight of 326.31 g/mol. Its IUPAC name is 2-acetyl-7-fluoro-1'-methyl-1,1-dioxospiro[1,2-benzothiazole-3,3'-pyrrolidine]-2',5'-dione.
| Compound Name | 2-acetyl-7-fluoro-1'-methyl-1,1-dioxospiro[1,2-benzothiazole-3,3'-pyrrolidine]-2',5'-dione |
|---|---|
| PubChem CID | 162350768 |
| Molecular Formula | C13H11FN2O5S |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 2-acetyl-7-fluoro-1'-methyl-1,1-dioxospiro[1,2-benzothiazole-3,3'-pyrrolidine]-2',5'-dione |
| SMILES | CC(=O)N1C2(CC(=O)N(C)C2=O)c2cccc(F)c2S1(=O)=O |
| InChI | InChI=1S/C13H11FN2O5S/c1-7(17)16-13(6-10(18)15(2)12(13)19)8-4-3-5-9(14)11(8)22(16,20)21/h3-5H,6H2,1-2H3 |
| InChIKey | PGAJMSGARHSGKR-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|