C13H11BrN2O5S — CID 162350778
2-acetyl-5-bromo-1'-methyl-1,1-dioxospiro[1,2-benzothiazole-3,3'-pyrrolidine]-2',5'-dione (PubChem CID 162350778) has the molecular formula C13H11BrN2O5S and a molecular weight of 387.21 g/mol. Its IUPAC name is 2-acetyl-5-bromo-1'-methyl-1,1-dioxospiro[1,2-benzothiazole-3,3'-pyrrolidine]-2',5'-dione.
| Compound Name | 2-acetyl-5-bromo-1'-methyl-1,1-dioxospiro[1,2-benzothiazole-3,3'-pyrrolidine]-2',5'-dione |
|---|---|
| PubChem CID | 162350778 |
| Molecular Formula | C13H11BrN2O5S |
| Molecular Weight | 387.21 g/mol |
| Exact Mass | 385.96 |
| IUPAC Name | 2-acetyl-5-bromo-1'-methyl-1,1-dioxospiro[1,2-benzothiazole-3,3'-pyrrolidine]-2',5'-dione |
| SMILES | CC(=O)N1C2(CC(=O)N(C)C2=O)c2cc(Br)ccc2S1(=O)=O |
| InChI | InChI=1S/C13H11BrN2O5S/c1-7(17)16-13(6-11(18)15(2)12(13)19)9-5-8(14)3-4-10(9)22(16,20)21/h3-5H,6H2,1-2H3 |
| InChIKey | PHJSVASVSDEVCL-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.21 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|