About CID 162350816
CID 162350816 (PubChem CID 162350816) has the molecular formula C10H15O3Si
and a molecular weight of 211.31 g/mol.
Molecular Properties
| Compound Name | CID 162350816 |
| PubChem CID | 162350816 |
| Molecular Formula | C10H15O3Si |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | — |
| SMILES | CC1(CCC2OC2(C)C[Si])OC1C=O |
| InChI | InChI=1S/C10H15O3Si/c1-9(8(5-11)13-9)4-3-7-10(2,6-14)12-7/h5,7-8H,3-4,6H2,1-2H3 |
| InChIKey | GVKNADMKGDRNIK-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 42.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze CID 162350816 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162350816?
The IUPAC name of CID 162350816 (CID 162350816) is not available.
What is the SMILES notation for CID 162350816?
The canonical SMILES for CID 162350816 is CC1(CCC2OC2(C)C[Si])OC1C=O.
What is the InChIKey of CID 162350816?
The InChIKey is GVKNADMKGDRNIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15O3Si/c1-9(8(5-11)13-9)4-3-7-10(2,6-14)12-7/h5,7-8H,3-4,6H2,1-2H3.
What are the key properties of CID 162350816?
CID 162350816 has a molecular weight of 211.31 g/mol, XLogP of 0.87, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162350816 is sourced from PubChem (CID 162350816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).