C26H22F3NO6 — CID 162350845
2-benzamido-2-(4-methoxyphenyl)-3-[4-(trifluoromethyl)phenyl]pentanedioic acid (PubChem CID 162350845) has the molecular formula C26H22F3NO6 and a molecular weight of 501.46 g/mol. Its IUPAC name is 2-benzamido-2-(4-methoxyphenyl)-3-[4-(trifluoromethyl)phenyl]pentanedioic acid.
| Compound Name | 2-benzamido-2-(4-methoxyphenyl)-3-[4-(trifluoromethyl)phenyl]pentanedioic acid |
|---|---|
| PubChem CID | 162350845 |
| Molecular Formula | C26H22F3NO6 |
| Molecular Weight | 501.46 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | 2-benzamido-2-(4-methoxyphenyl)-3-[4-(trifluoromethyl)phenyl]pentanedioic acid |
| SMILES | COc1ccc(C(NC(=O)c2ccccc2)(C(=O)O)C(CC(=O)O)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C26H22F3NO6/c1-36-20-13-11-18(12-14-20)25(24(34)35,30-23(33)17-5-3-2-4-6-17)21(15-22(31)32)16-7-9-19(10-8-16)26(27,28)29/h2-14,21H,15H2,1H3,(H,30,33)(H,31,32)(H,34,35) |
| InChIKey | IBRHWLYIECDYGI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |