C17H14ClF3N2O — CID 162350913
2-chloro-6-[4-methyl-2-[4-(trifluoromethyl)phenyl]-3,4-dihydropyrazol-5-yl]phenol (PubChem CID 162350913) has the molecular formula C17H14ClF3N2O and a molecular weight of 354.76 g/mol. Its IUPAC name is 2-chloro-6-[4-methyl-2-[4-(trifluoromethyl)phenyl]-3,4-dihydropyrazol-5-yl]phenol.
| Compound Name | 2-chloro-6-[4-methyl-2-[4-(trifluoromethyl)phenyl]-3,4-dihydropyrazol-5-yl]phenol |
|---|---|
| PubChem CID | 162350913 |
| Molecular Formula | C17H14ClF3N2O |
| Molecular Weight | 354.76 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 2-chloro-6-[4-methyl-2-[4-(trifluoromethyl)phenyl]-3,4-dihydropyrazol-5-yl]phenol |
| SMILES | CC1CN(c2ccc(C(F)(F)F)cc2)N=C1c1cccc(Cl)c1O |
| InChI | InChI=1S/C17H14ClF3N2O/c1-10-9-23(12-7-5-11(6-8-12)17(19,20)21)22-15(10)13-3-2-4-14(18)16(13)24/h2-8,10,24H,9H2,1H3 |
| InChIKey | ATWFQQDYQVQRSH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.76 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'} |
|---|