About (4S)-5,5-dimethyl-4-phenyl-4,6-dihydro-1H-pyrimidine
(4S)-5,5-dimethyl-4-phenyl-4,6-dihydro-1H-pyrimidine (PubChem CID 162350993) has the molecular formula C12H16N2
and a molecular weight of 188.27 g/mol. Its IUPAC name is (4S)-5,5-dimethyl-4-phenyl-4,6-dihydro-1H-pyrimidine.
Molecular Properties
| Compound Name | (4S)-5,5-dimethyl-4-phenyl-4,6-dihydro-1H-pyrimidine |
| PubChem CID | 162350993 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | (4S)-5,5-dimethyl-4-phenyl-4,6-dihydro-1H-pyrimidine |
| SMILES | CC1(C)CNC=N[C@H]1c1ccccc1 |
| InChI | InChI=1S/C12H16N2/c1-12(2)8-13-9-14-11(12)10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3,(H,13,14)/t11-/m0/s1 |
| InChIKey | YBWCYSFSGHUFBG-NSHDSACASA-N |
| XLogP | 2.39 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-5,5-dimethyl-4-phenyl-4,6-dihydro-1H-pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-5,5-dimethyl-4-phenyl-4,6-dihydro-1H-pyrimidine?
The IUPAC name of (4S)-5,5-dimethyl-4-phenyl-4,6-dihydro-1H-pyrimidine (CID 162350993) is (4S)-5,5-dimethyl-4-phenyl-4,6-dihydro-1H-pyrimidine.
What is the SMILES notation for (4S)-5,5-dimethyl-4-phenyl-4,6-dihydro-1H-pyrimidine?
The canonical SMILES for (4S)-5,5-dimethyl-4-phenyl-4,6-dihydro-1H-pyrimidine is CC1(C)CNC=N[C@H]1c1ccccc1.
What is the InChIKey of (4S)-5,5-dimethyl-4-phenyl-4,6-dihydro-1H-pyrimidine?
The InChIKey is YBWCYSFSGHUFBG-NSHDSACASA-N. The full InChI is InChI=1S/C12H16N2/c1-12(2)8-13-9-14-11(12)10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3,(H,13,14)/t11-/m0/s1.
What are the key properties of (4S)-5,5-dimethyl-4-phenyl-4,6-dihydro-1H-pyrimidine?
(4S)-5,5-dimethyl-4-phenyl-4,6-dihydro-1H-pyrimidine has a molecular weight of 188.27 g/mol, XLogP of 2.39, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-5,5-dimethyl-4-phenyl-4,6-dihydro-1H-pyrimidine is sourced from PubChem (CID 162350993), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).