About [(2S)-5,5-dimethyl-2H-furan-2-yl]methyl trifluoromethanesulfonate
[(2S)-5,5-dimethyl-2H-furan-2-yl]methyl trifluoromethanesulfonate (PubChem CID 162351022) has the molecular formula C8H11F3O4S
and a molecular weight of 260.23 g/mol. Its IUPAC name is [(2S)-5,5-dimethyl-2H-furan-2-yl]methyl trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [(2S)-5,5-dimethyl-2H-furan-2-yl]methyl trifluoromethanesulfonate |
| PubChem CID | 162351022 |
| Molecular Formula | C8H11F3O4S |
| Molecular Weight | 260.23 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | [(2S)-5,5-dimethyl-2H-furan-2-yl]methyl trifluoromethanesulfonate |
| SMILES | CC1(C)C=C[C@@H](COS(=O)(=O)C(F)(F)F)O1 |
| InChI | InChI=1S/C8H11F3O4S/c1-7(2)4-3-6(15-7)5-14-16(12,13)8(9,10)11/h3-4,6H,5H2,1-2H3/t6-/m0/s1 |
| InChIKey | CXARUFRQEUCEAG-LURJTMIESA-N |
| XLogP | 1.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.23 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-5,5-dimethyl-2H-furan-2-yl]methyl trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-5,5-dimethyl-2H-furan-2-yl]methyl trifluoromethanesulfonate?
The IUPAC name of [(2S)-5,5-dimethyl-2H-furan-2-yl]methyl trifluoromethanesulfonate (CID 162351022) is [(2S)-5,5-dimethyl-2H-furan-2-yl]methyl trifluoromethanesulfonate.
What is the SMILES notation for [(2S)-5,5-dimethyl-2H-furan-2-yl]methyl trifluoromethanesulfonate?
The canonical SMILES for [(2S)-5,5-dimethyl-2H-furan-2-yl]methyl trifluoromethanesulfonate is CC1(C)C=C[C@@H](COS(=O)(=O)C(F)(F)F)O1.
What is the InChIKey of [(2S)-5,5-dimethyl-2H-furan-2-yl]methyl trifluoromethanesulfonate?
The InChIKey is CXARUFRQEUCEAG-LURJTMIESA-N. The full InChI is InChI=1S/C8H11F3O4S/c1-7(2)4-3-6(15-7)5-14-16(12,13)8(9,10)11/h3-4,6H,5H2,1-2H3/t6-/m0/s1.
What are the key properties of [(2S)-5,5-dimethyl-2H-furan-2-yl]methyl trifluoromethanesulfonate?
[(2S)-5,5-dimethyl-2H-furan-2-yl]methyl trifluoromethanesulfonate has a molecular weight of 260.23 g/mol, XLogP of 1.59, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-5,5-dimethyl-2H-furan-2-yl]methyl trifluoromethanesulfonate is sourced from PubChem (CID 162351022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).