C29H34F3N5O5Si — CID 162351282
methyl 4-[3-(4-methoxyphenyl)-2-oxo-7-[2,2,2-trifluoroethyl(2-trimethylsilylethoxymethyl)amino]-4H-pyrimido[4,5-d]pyrimidin-1-yl]benzoate (PubChem CID 162351282) has the molecular formula C29H34F3N5O5Si and a molecular weight of 617.70 g/mol. Its IUPAC name is methyl 4-[3-(4-methoxyphenyl)-2-oxo-7-[2,2,2-trifluoroethyl(2-trimethylsilylethoxymethyl)amino]-4H-pyrimido[4,5-d]pyrimidin-1-yl]benzoate.
| Compound Name | methyl 4-[3-(4-methoxyphenyl)-2-oxo-7-[2,2,2-trifluoroethyl(2-trimethylsilylethoxymethyl)amino]-4H-pyrimido[4,5-d]pyrimidin-1-yl]benzoate |
|---|---|
| PubChem CID | 162351282 |
| Molecular Formula | C29H34F3N5O5Si |
| Molecular Weight | 617.70 g/mol |
| Exact Mass | 617.23 |
| IUPAC Name | methyl 4-[3-(4-methoxyphenyl)-2-oxo-7-[2,2,2-trifluoroethyl(2-trimethylsilylethoxymethyl)amino]-4H-pyrimido[4,5-d]pyrimidin-1-yl]benzoate |
| SMILES | COC(=O)c1ccc(N2C(=O)N(c3ccc(OC)cc3)Cc3cnc(N(COCC[Si](C)(C)C)CC(F)(F)F)nc32)cc1 |
| InChI | InChI=1S/C29H34F3N5O5Si/c1-40-24-12-10-22(11-13-24)36-17-21-16-33-27(35(18-29(30,31)32)19-42-14-15-43(3,4)5)34-25(21)37(28(36)39)23-8-6-20(7-9-23)26(38)41-2/h6-13,16H,14-15,17-19H2,1-5H3 |
| InChIKey | UWBSIORBVCFVDB-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 97.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.70 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|