C8H6BrN3 — CID 162351547
1-(2-bromophenyl)-4,5-dideuteriotriazole (PubChem CID 162351547) has the molecular formula C8H6BrN3 and a molecular weight of 226.07 g/mol. Its IUPAC name is 1-(2-bromophenyl)-4,5-dideuteriotriazole.
| Compound Name | 1-(2-bromophenyl)-4,5-dideuteriotriazole |
|---|---|
| PubChem CID | 162351547 |
| Molecular Formula | C8H6BrN3 |
| Molecular Weight | 226.07 g/mol |
| Exact Mass | 224.99 |
| IUPAC Name | 1-(2-bromophenyl)-4,5-dideuteriotriazole |
| SMILES | [2H]c1nnn(-c2ccccc2Br)c1[2H] |
| InChI | InChI=1S/C8H6BrN3/c9-7-3-1-2-4-8(7)12-6-5-10-11-12/h1-6H/i5D,6D |
| InChIKey | VANZBHFMPXRLDI-KCZCTXNHSA-N |
| XLogP | 2.03 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.07 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |