C19H23FN6O — CID 162351827
8-[2-(3-amino-4-fluoroanilino)-5-methylpyrimidin-4-yl]-2,8-diazaspiro[4.5]decan-1-one (PubChem CID 162351827) has the molecular formula C19H23FN6O and a molecular weight of 370.43 g/mol. Its IUPAC name is 8-[2-(3-amino-4-fluoroanilino)-5-methylpyrimidin-4-yl]-2,8-diazaspiro[4.5]decan-1-one.
| Compound Name | 8-[2-(3-amino-4-fluoroanilino)-5-methylpyrimidin-4-yl]-2,8-diazaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 162351827 |
| Molecular Formula | C19H23FN6O |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 8-[2-(3-amino-4-fluoroanilino)-5-methylpyrimidin-4-yl]-2,8-diazaspiro[4.5]decan-1-one |
| SMILES | Cc1cnc(Nc2ccc(F)c(N)c2)nc1N1CCC2(CCNC2=O)CC1 |
| InChI | InChI=1S/C19H23FN6O/c1-12-11-23-18(24-13-2-3-14(20)15(21)10-13)25-16(12)26-8-5-19(6-9-26)4-7-22-17(19)27/h2-3,10-11H,4-9,21H2,1H3,(H,22,27)(H,23,24,25) |
| InChIKey | DWFMCQDMISEREG-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 96.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|