C20H20N4O3 — CID 162351907
butyl 1-oxo-3-phenyl-4H-[1,2,4]triazino[4,5-a]benzimidazole-2-carboxylate (PubChem CID 162351907) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is butyl 1-oxo-3-phenyl-4H-[1,2,4]triazino[4,5-a]benzimidazole-2-carboxylate.
| Compound Name | butyl 1-oxo-3-phenyl-4H-[1,2,4]triazino[4,5-a]benzimidazole-2-carboxylate |
|---|---|
| PubChem CID | 162351907 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | butyl 1-oxo-3-phenyl-4H-[1,2,4]triazino[4,5-a]benzimidazole-2-carboxylate |
| SMILES | CCCCOC(=O)N1C(=O)n2c(nc3ccccc32)CN1c1ccccc1 |
| InChI | InChI=1S/C20H20N4O3/c1-2-3-13-27-20(26)24-19(25)23-17-12-8-7-11-16(17)21-18(23)14-22(24)15-9-5-4-6-10-15/h4-12H,2-3,13-14H2,1H3 |
| InChIKey | FIYLERSFEFBNKO-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 67.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|