About 1,2-bis(4-bromophenyl)-4-phenyl-1,2,4-triazolidine
1,2-bis(4-bromophenyl)-4-phenyl-1,2,4-triazolidine (PubChem CID 162352101) has the molecular formula C20H17Br2N3
and a molecular weight of 459.19 g/mol. Its IUPAC name is 1,2-bis(4-bromophenyl)-4-phenyl-1,2,4-triazolidine.
Molecular Properties
| Compound Name | 1,2-bis(4-bromophenyl)-4-phenyl-1,2,4-triazolidine |
| PubChem CID | 162352101 |
| Molecular Formula | C20H17Br2N3 |
| Molecular Weight | 459.19 g/mol |
| Exact Mass | 456.98 |
| IUPAC Name | 1,2-bis(4-bromophenyl)-4-phenyl-1,2,4-triazolidine |
| SMILES | Brc1ccc(N2CN(c3ccccc3)CN2c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C20H17Br2N3/c21-16-6-10-19(11-7-16)24-14-23(18-4-2-1-3-5-18)15-25(24)20-12-8-17(22)9-13-20/h1-13H,14-15H2 |
| InChIKey | WKVXJZDDCKWLOV-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.19 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,2-bis(4-bromophenyl)-4-phenyl-1,2,4-triazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis(4-bromophenyl)-4-phenyl-1,2,4-triazolidine?
The IUPAC name of 1,2-bis(4-bromophenyl)-4-phenyl-1,2,4-triazolidine (CID 162352101) is 1,2-bis(4-bromophenyl)-4-phenyl-1,2,4-triazolidine.
What is the SMILES notation for 1,2-bis(4-bromophenyl)-4-phenyl-1,2,4-triazolidine?
The canonical SMILES for 1,2-bis(4-bromophenyl)-4-phenyl-1,2,4-triazolidine is Brc1ccc(N2CN(c3ccccc3)CN2c2ccc(Br)cc2)cc1.
What is the InChIKey of 1,2-bis(4-bromophenyl)-4-phenyl-1,2,4-triazolidine?
The InChIKey is WKVXJZDDCKWLOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17Br2N3/c21-16-6-10-19(11-7-16)24-14-23(18-4-2-1-3-5-18)15-25(24)20-12-8-17(22)9-13-20/h1-13H,14-15H2.
What are the key properties of 1,2-bis(4-bromophenyl)-4-phenyl-1,2,4-triazolidine?
1,2-bis(4-bromophenyl)-4-phenyl-1,2,4-triazolidine has a molecular weight of 459.19 g/mol, XLogP of 5.87, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(4-bromophenyl)-4-phenyl-1,2,4-triazolidine is sourced from PubChem (CID 162352101), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).