About ethyl 2-methyl-3-oxo-2-(2,2,2-trifluoroethyl)pent-4-enoate
ethyl 2-methyl-3-oxo-2-(2,2,2-trifluoroethyl)pent-4-enoate (PubChem CID 162352119) has the molecular formula C10H13F3O3
and a molecular weight of 238.20 g/mol. Its IUPAC name is ethyl 2-methyl-3-oxo-2-(2,2,2-trifluoroethyl)pent-4-enoate.
Molecular Properties
| Compound Name | ethyl 2-methyl-3-oxo-2-(2,2,2-trifluoroethyl)pent-4-enoate |
| PubChem CID | 162352119 |
| Molecular Formula | C10H13F3O3 |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | ethyl 2-methyl-3-oxo-2-(2,2,2-trifluoroethyl)pent-4-enoate |
| SMILES | C=CC(=O)C(C)(CC(F)(F)F)C(=O)OCC |
| InChI | InChI=1S/C10H13F3O3/c1-4-7(14)9(3,6-10(11,12)13)8(15)16-5-2/h4H,1,5-6H2,2-3H3 |
| InChIKey | DROPPCWUZNCFPS-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-methyl-3-oxo-2-(2,2,2-trifluoroethyl)pent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-methyl-3-oxo-2-(2,2,2-trifluoroethyl)pent-4-enoate?
The IUPAC name of ethyl 2-methyl-3-oxo-2-(2,2,2-trifluoroethyl)pent-4-enoate (CID 162352119) is ethyl 2-methyl-3-oxo-2-(2,2,2-trifluoroethyl)pent-4-enoate.
What is the SMILES notation for ethyl 2-methyl-3-oxo-2-(2,2,2-trifluoroethyl)pent-4-enoate?
The canonical SMILES for ethyl 2-methyl-3-oxo-2-(2,2,2-trifluoroethyl)pent-4-enoate is C=CC(=O)C(C)(CC(F)(F)F)C(=O)OCC.
What is the InChIKey of ethyl 2-methyl-3-oxo-2-(2,2,2-trifluoroethyl)pent-4-enoate?
The InChIKey is DROPPCWUZNCFPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F3O3/c1-4-7(14)9(3,6-10(11,12)13)8(15)16-5-2/h4H,1,5-6H2,2-3H3.
What are the key properties of ethyl 2-methyl-3-oxo-2-(2,2,2-trifluoroethyl)pent-4-enoate?
ethyl 2-methyl-3-oxo-2-(2,2,2-trifluoroethyl)pent-4-enoate has a molecular weight of 238.20 g/mol, XLogP of 2.26, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-methyl-3-oxo-2-(2,2,2-trifluoroethyl)pent-4-enoate is sourced from PubChem (CID 162352119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).