C24H18ClN3O — CID 162352429
(2R,3R)-5-(5-chloro-1H-indol-3-yl)-2,3-diphenyl-2,3-dihydro-1H-pyrazin-6-one (PubChem CID 162352429) has the molecular formula C24H18ClN3O and a molecular weight of 399.88 g/mol. Its IUPAC name is (2R,3R)-5-(5-chloro-1H-indol-3-yl)-2,3-diphenyl-2,3-dihydro-1H-pyrazin-6-one.
| Compound Name | (2R,3R)-5-(5-chloro-1H-indol-3-yl)-2,3-diphenyl-2,3-dihydro-1H-pyrazin-6-one |
|---|---|
| PubChem CID | 162352429 |
| Molecular Formula | C24H18ClN3O |
| Molecular Weight | 399.88 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | (2R,3R)-5-(5-chloro-1H-indol-3-yl)-2,3-diphenyl-2,3-dihydro-1H-pyrazin-6-one |
| SMILES | O=C1N[C@H](c2ccccc2)[C@@H](c2ccccc2)N=C1c1c[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C24H18ClN3O/c25-17-11-12-20-18(13-17)19(14-26-20)23-24(29)28-22(16-9-5-2-6-10-16)21(27-23)15-7-3-1-4-8-15/h1-14,21-22,26H,(H,28,29)/t21-,22-/m1/s1 |
| InChIKey | IVKTWXNJOQWQEL-FGZHOGPDSA-N |
| XLogP | 5.22 |
| TPSA | 57.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.88 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |