About CID 162352840
CID 162352840 (PubChem CID 162352840) has the molecular formula C21H39Si
and a molecular weight of 319.63 g/mol.
Molecular Properties
| Compound Name | CID 162352840 |
| PubChem CID | 162352840 |
| Molecular Formula | C21H39Si |
| Molecular Weight | 319.63 g/mol |
| Exact Mass | 319.28 |
| IUPAC Name | — |
| SMILES | CCCCCC[Si](CCCCCC)C1C(C)=C(C)C(C)=C1C |
| InChI | InChI=1S/C21H39Si/c1-7-9-11-13-15-22(16-14-12-10-8-2)21-19(5)17(3)18(4)20(21)6/h21H,7-16H2,1-6H3 |
| InChIKey | DOCKUGVNWPFMEG-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 319.63 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 162352840 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162352840?
The IUPAC name of CID 162352840 (CID 162352840) is not available.
What is the SMILES notation for CID 162352840?
The canonical SMILES for CID 162352840 is CCCCCC[Si](CCCCCC)C1C(C)=C(C)C(C)=C1C.
What is the InChIKey of CID 162352840?
The InChIKey is DOCKUGVNWPFMEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H39Si/c1-7-9-11-13-15-22(16-14-12-10-8-2)21-19(5)17(3)18(4)20(21)6/h21H,7-16H2,1-6H3.
What are the key properties of CID 162352840?
CID 162352840 has a molecular weight of 319.63 g/mol, XLogP of 7.70, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162352840 is sourced from PubChem (CID 162352840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).