About 1H-pyrrolo[2,3-f]quinazoline-2,3-dione
1H-pyrrolo[2,3-f]quinazoline-2,3-dione (PubChem CID 162353017) has the molecular formula C10H5N3O2
and a molecular weight of 199.17 g/mol. Its IUPAC name is 1H-pyrrolo[2,3-f]quinazoline-2,3-dione.
Molecular Properties
| Compound Name | 1H-pyrrolo[2,3-f]quinazoline-2,3-dione |
| PubChem CID | 162353017 |
| Molecular Formula | C10H5N3O2 |
| Molecular Weight | 199.17 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | 1H-pyrrolo[2,3-f]quinazoline-2,3-dione |
| SMILES | O=C1Nc2c(ccc3ncncc23)C1=O |
| InChI | InChI=1S/C10H5N3O2/c14-9-5-1-2-7-6(3-11-4-12-7)8(5)13-10(9)15/h1-4H,(H,13,14,15) |
| InChIKey | TZDWPJOMMLPHOK-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.17 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1H-pyrrolo[2,3-f]quinazoline-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrrolo[2,3-f]quinazoline-2,3-dione?
The IUPAC name of 1H-pyrrolo[2,3-f]quinazoline-2,3-dione (CID 162353017) is 1H-pyrrolo[2,3-f]quinazoline-2,3-dione.
What is the SMILES notation for 1H-pyrrolo[2,3-f]quinazoline-2,3-dione?
The canonical SMILES for 1H-pyrrolo[2,3-f]quinazoline-2,3-dione is O=C1Nc2c(ccc3ncncc23)C1=O.
What is the InChIKey of 1H-pyrrolo[2,3-f]quinazoline-2,3-dione?
The InChIKey is TZDWPJOMMLPHOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5N3O2/c14-9-5-1-2-7-6(3-11-4-12-7)8(5)13-10(9)15/h1-4H,(H,13,14,15).
What are the key properties of 1H-pyrrolo[2,3-f]quinazoline-2,3-dione?
1H-pyrrolo[2,3-f]quinazoline-2,3-dione has a molecular weight of 199.17 g/mol, XLogP of 0.76, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrrolo[2,3-f]quinazoline-2,3-dione is sourced from PubChem (CID 162353017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).