About 3-(3,4-dihydro-2H-quinolin-1-yl)-1-(3-hydroxypiperidin-1-yl)propan-1-one
3-(3,4-dihydro-2H-quinolin-1-yl)-1-(3-hydroxypiperidin-1-yl)propan-1-one (PubChem CID 162353378) has the molecular formula C17H24N2O2
and a molecular weight of 288.39 g/mol. Its IUPAC name is 3-(3,4-dihydro-2H-quinolin-1-yl)-1-(3-hydroxypiperidin-1-yl)propan-1-one.
Molecular Properties
| Compound Name | 3-(3,4-dihydro-2H-quinolin-1-yl)-1-(3-hydroxypiperidin-1-yl)propan-1-one |
| PubChem CID | 162353378 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 3-(3,4-dihydro-2H-quinolin-1-yl)-1-(3-hydroxypiperidin-1-yl)propan-1-one |
| SMILES | O=C(CCN1CCCc2ccccc21)N1CCCC(O)C1 |
| InChI | InChI=1S/C17H24N2O2/c20-15-7-4-11-19(13-15)17(21)9-12-18-10-3-6-14-5-1-2-8-16(14)18/h1-2,5,8,15,20H,3-4,6-7,9-13H2 |
| InChIKey | ZJCVMKKAPWXWHV-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(3,4-dihydro-2H-quinolin-1-yl)-1-(3-hydroxypiperidin-1-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,4-dihydro-2H-quinolin-1-yl)-1-(3-hydroxypiperidin-1-yl)propan-1-one?
The IUPAC name of 3-(3,4-dihydro-2H-quinolin-1-yl)-1-(3-hydroxypiperidin-1-yl)propan-1-one (CID 162353378) is 3-(3,4-dihydro-2H-quinolin-1-yl)-1-(3-hydroxypiperidin-1-yl)propan-1-one.
What is the SMILES notation for 3-(3,4-dihydro-2H-quinolin-1-yl)-1-(3-hydroxypiperidin-1-yl)propan-1-one?
The canonical SMILES for 3-(3,4-dihydro-2H-quinolin-1-yl)-1-(3-hydroxypiperidin-1-yl)propan-1-one is O=C(CCN1CCCc2ccccc21)N1CCCC(O)C1.
What is the InChIKey of 3-(3,4-dihydro-2H-quinolin-1-yl)-1-(3-hydroxypiperidin-1-yl)propan-1-one?
The InChIKey is ZJCVMKKAPWXWHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O2/c20-15-7-4-11-19(13-15)17(21)9-12-18-10-3-6-14-5-1-2-8-16(14)18/h1-2,5,8,15,20H,3-4,6-7,9-13H2.
What are the key properties of 3-(3,4-dihydro-2H-quinolin-1-yl)-1-(3-hydroxypiperidin-1-yl)propan-1-one?
3-(3,4-dihydro-2H-quinolin-1-yl)-1-(3-hydroxypiperidin-1-yl)propan-1-one has a molecular weight of 288.39 g/mol, XLogP of 1.81, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,4-dihydro-2H-quinolin-1-yl)-1-(3-hydroxypiperidin-1-yl)propan-1-one is sourced from PubChem (CID 162353378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).