C8H15NO3 — CID 162353629
2-(2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl)ethanol (PubChem CID 162353629) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is 2-(2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl)ethanol.
| Compound Name | 2-(2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl)ethanol |
|---|---|
| PubChem CID | 162353629 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | 2-(2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl)ethanol |
| SMILES | OCCN1CC2OCCOC2C1 |
| InChI | InChI=1S/C8H15NO3/c10-2-1-9-5-7-8(6-9)12-4-3-11-7/h7-8,10H,1-6H2 |
| InChIKey | UJMXVSVRKCKMHH-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |