C25H14BrF6N — CID 162353944
4-(4-bromophenyl)-2,6-bis[4-(trifluoromethyl)phenyl]pyridine (PubChem CID 162353944) has the molecular formula C25H14BrF6N and a molecular weight of 522.29 g/mol. Its IUPAC name is 4-(4-bromophenyl)-2,6-bis[4-(trifluoromethyl)phenyl]pyridine.
| Compound Name | 4-(4-bromophenyl)-2,6-bis[4-(trifluoromethyl)phenyl]pyridine |
|---|---|
| PubChem CID | 162353944 |
| Molecular Formula | C25H14BrF6N |
| Molecular Weight | 522.29 g/mol |
| Exact Mass | 521.02 |
| IUPAC Name | 4-(4-bromophenyl)-2,6-bis[4-(trifluoromethyl)phenyl]pyridine |
| SMILES | FC(F)(F)c1ccc(-c2cc(-c3ccc(Br)cc3)cc(-c3ccc(C(F)(F)F)cc3)n2)cc1 |
| InChI | InChI=1S/C25H14BrF6N/c26-21-11-5-15(6-12-21)18-13-22(16-1-7-19(8-2-16)24(27,28)29)33-23(14-18)17-3-9-20(10-4-17)25(30,31)32/h1-14H |
| InChIKey | JPSLJAGOBVUJES-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.29 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |