C17H15F2N7S — CID 162355198
3-[5-[(2,5-difluorophenyl)methyl-methylamino]pyrazolo[1,5-a]pyrimidin-3-yl]-1-isocyano-1-methylthiourea (PubChem CID 162355198) has the molecular formula C17H15F2N7S and a molecular weight of 387.42 g/mol. Its IUPAC name is 3-[5-[(2,5-difluorophenyl)methyl-methylamino]pyrazolo[1,5-a]pyrimidin-3-yl]-1-isocyano-1-methylthiourea.
| Compound Name | 3-[5-[(2,5-difluorophenyl)methyl-methylamino]pyrazolo[1,5-a]pyrimidin-3-yl]-1-isocyano-1-methylthiourea |
|---|---|
| PubChem CID | 162355198 |
| Molecular Formula | C17H15F2N7S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 3-[5-[(2,5-difluorophenyl)methyl-methylamino]pyrazolo[1,5-a]pyrimidin-3-yl]-1-isocyano-1-methylthiourea |
| SMILES | [C-]#[N+]N(C)C(=S)Nc1cnn2ccc(N(C)Cc3cc(F)ccc3F)nc12 |
| InChI | InChI=1S/C17H15F2N7S/c1-20-25(3)17(27)22-14-9-21-26-7-6-15(23-16(14)26)24(2)10-11-8-12(18)4-5-13(11)19/h4-9H,10H2,2-3H3,(H,22,27) |
| InChIKey | NKYINXHALLDHEY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 53.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|