C19H15IN2O4 — CID 162355858
phenyl 2-(6-iodo-2-methoxy-1-oxo-3H-imidazo[1,5-a]indol-3-yl)acetate (PubChem CID 162355858) has the molecular formula C19H15IN2O4 and a molecular weight of 462.24 g/mol. Its IUPAC name is phenyl 2-(6-iodo-2-methoxy-1-oxo-3H-imidazo[1,5-a]indol-3-yl)acetate.
| Compound Name | phenyl 2-(6-iodo-2-methoxy-1-oxo-3H-imidazo[1,5-a]indol-3-yl)acetate |
|---|---|
| PubChem CID | 162355858 |
| Molecular Formula | C19H15IN2O4 |
| Molecular Weight | 462.24 g/mol |
| Exact Mass | 462.01 |
| IUPAC Name | phenyl 2-(6-iodo-2-methoxy-1-oxo-3H-imidazo[1,5-a]indol-3-yl)acetate |
| SMILES | CON1C(=O)n2c(cc3cc(I)ccc32)C1CC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C19H15IN2O4/c1-25-22-17(11-18(23)26-14-5-3-2-4-6-14)16-10-12-9-13(20)7-8-15(12)21(16)19(22)24/h2-10,17H,11H2,1H3 |
| InChIKey | WVOUYHMTUXJPSJ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.24 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|