C33H34N2O10S — CID 162355968
5,7-dimethoxy-3-[4-[[5-(2-methoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]butoxy]-2-(3,4,5-trimethoxyphenyl)chromen-4-one (PubChem CID 162355968) has the molecular formula C33H34N2O10S and a molecular weight of 650.71 g/mol. Its IUPAC name is 5,7-dimethoxy-3-[4-[[5-(2-methoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]butoxy]-2-(3,4,5-trimethoxyphenyl)chromen-4-one.
| Compound Name | 5,7-dimethoxy-3-[4-[[5-(2-methoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]butoxy]-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 162355968 |
| Molecular Formula | C33H34N2O10S |
| Molecular Weight | 650.71 g/mol |
| Exact Mass | 650.19 |
| IUPAC Name | 5,7-dimethoxy-3-[4-[[5-(2-methoxyphenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]butoxy]-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
| SMILES | COc1cc(OC)c2c(=O)c(OCCCCSc3nnc(-c4ccccc4OC)o3)c(-c3cc(OC)c(OC)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C33H34N2O10S/c1-37-20-17-23(39-3)27-24(18-20)44-29(19-15-25(40-4)30(42-6)26(16-19)41-5)31(28(27)36)43-13-9-10-14-46-33-35-34-32(45-33)21-11-7-8-12-22(21)38-2/h7-8,11-12,15-18H,9-10,13-14H2,1-6H3 |
| InChIKey | YCYFDFQTRYAICA-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 133.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.71 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|