C29H26N2O7S — CID 162355969
3-[3-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]propoxy]-2-(3,4,5-trimethoxyphenyl)chromen-4-one (PubChem CID 162355969) has the molecular formula C29H26N2O7S and a molecular weight of 546.60 g/mol. Its IUPAC name is 3-[3-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]propoxy]-2-(3,4,5-trimethoxyphenyl)chromen-4-one.
| Compound Name | 3-[3-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]propoxy]-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 162355969 |
| Molecular Formula | C29H26N2O7S |
| Molecular Weight | 546.60 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | 3-[3-[(5-phenyl-1,3,4-oxadiazol-2-yl)sulfanyl]propoxy]-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
| SMILES | COc1cc(-c2oc3ccccc3c(=O)c2OCCCSc2nnc(-c3ccccc3)o2)cc(OC)c1OC |
| InChI | InChI=1S/C29H26N2O7S/c1-33-22-16-19(17-23(34-2)26(22)35-3)25-27(24(32)20-12-7-8-13-21(20)37-25)36-14-9-15-39-29-31-30-28(38-29)18-10-5-4-6-11-18/h4-8,10-13,16-17H,9,14-15H2,1-3H3 |
| InChIKey | OMMYEGNSNBLHIA-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 106.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.60 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|