C32H30F2N2O9S — CID 162355981
3-[4-[[5-(2,4-difluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]butoxy]-5,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one (PubChem CID 162355981) has the molecular formula C32H30F2N2O9S and a molecular weight of 656.66 g/mol. Its IUPAC name is 3-[4-[[5-(2,4-difluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]butoxy]-5,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one.
| Compound Name | 3-[4-[[5-(2,4-difluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]butoxy]-5,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 162355981 |
| Molecular Formula | C32H30F2N2O9S |
| Molecular Weight | 656.66 g/mol |
| Exact Mass | 656.16 |
| IUPAC Name | 3-[4-[[5-(2,4-difluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]butoxy]-5,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
| SMILES | COc1cc(OC)c2c(=O)c(OCCCCSc3nnc(-c4ccc(F)cc4F)o3)c(-c3cc(OC)c(OC)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C32H30F2N2O9S/c1-38-19-15-22(39-2)26-23(16-19)44-28(17-12-24(40-3)29(42-5)25(13-17)41-4)30(27(26)37)43-10-6-7-11-46-32-36-35-31(45-32)20-9-8-18(33)14-21(20)34/h8-9,12-16H,6-7,10-11H2,1-5H3 |
| InChIKey | BHKCIHLKINYYRM-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 124.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.66 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|