C32H31FN2O9S — CID 162355987
3-[4-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]butoxy]-5,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one (PubChem CID 162355987) has the molecular formula C32H31FN2O9S and a molecular weight of 638.67 g/mol. Its IUPAC name is 3-[4-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]butoxy]-5,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one.
| Compound Name | 3-[4-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]butoxy]-5,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 162355987 |
| Molecular Formula | C32H31FN2O9S |
| Molecular Weight | 638.67 g/mol |
| Exact Mass | 638.17 |
| IUPAC Name | 3-[4-[[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]butoxy]-5,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
| SMILES | COc1cc(OC)c2c(=O)c(OCCCCSc3nnc(-c4ccc(F)cc4)o3)c(-c3cc(OC)c(OC)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C32H31FN2O9S/c1-37-21-16-22(38-2)26-23(17-21)43-28(19-14-24(39-3)29(41-5)25(15-19)40-4)30(27(26)36)42-12-6-7-13-45-32-35-34-31(44-32)18-8-10-20(33)11-9-18/h8-11,14-17H,6-7,12-13H2,1-5H3 |
| InChIKey | CCVVCMZMWAJZQI-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 124.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.67 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|