C31H28F2N2O9S — CID 162355988
3-[3-[[5-(2,4-difluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]propoxy]-5,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one (PubChem CID 162355988) has the molecular formula C31H28F2N2O9S and a molecular weight of 642.63 g/mol. Its IUPAC name is 3-[3-[[5-(2,4-difluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]propoxy]-5,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one.
| Compound Name | 3-[3-[[5-(2,4-difluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]propoxy]-5,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
|---|---|
| PubChem CID | 162355988 |
| Molecular Formula | C31H28F2N2O9S |
| Molecular Weight | 642.63 g/mol |
| Exact Mass | 642.15 |
| IUPAC Name | 3-[3-[[5-(2,4-difluorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl]propoxy]-5,7-dimethoxy-2-(3,4,5-trimethoxyphenyl)chromen-4-one |
| SMILES | COc1cc(OC)c2c(=O)c(OCCCSc3nnc(-c4ccc(F)cc4F)o3)c(-c3cc(OC)c(OC)c(OC)c3)oc2c1 |
| InChI | InChI=1S/C31H28F2N2O9S/c1-37-18-14-21(38-2)25-22(15-18)43-27(16-11-23(39-3)28(41-5)24(12-16)40-4)29(26(25)36)42-9-6-10-45-31-35-34-30(44-31)19-8-7-17(32)13-20(19)33/h7-8,11-15H,6,9-10H2,1-5H3 |
| InChIKey | LXQQXFOEJQOMIO-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 124.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.63 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|