C29H33NO3 — CID 162356222
6-[2-[2-(4-hydroxyphenyl)ethenyl]-1,1,2-trimethylbenzo[e]indol-3-yl]hexanoic acid (PubChem CID 162356222) has the molecular formula C29H33NO3 and a molecular weight of 443.59 g/mol. Its IUPAC name is 6-[2-[2-(4-hydroxyphenyl)ethenyl]-1,1,2-trimethylbenzo[e]indol-3-yl]hexanoic acid.
| Compound Name | 6-[2-[2-(4-hydroxyphenyl)ethenyl]-1,1,2-trimethylbenzo[e]indol-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 162356222 |
| Molecular Formula | C29H33NO3 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | 6-[2-[2-(4-hydroxyphenyl)ethenyl]-1,1,2-trimethylbenzo[e]indol-3-yl]hexanoic acid |
| SMILES | CC1(C)c2c(ccc3ccccc23)N(CCCCCC(=O)O)C1(C)C=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C29H33NO3/c1-28(2)27-24-10-7-6-9-22(24)14-17-25(27)30(20-8-4-5-11-26(32)33)29(28,3)19-18-21-12-15-23(31)16-13-21/h6-7,9-10,12-19,31H,4-5,8,11,20H2,1-3H3,(H,32,33) |
| InChIKey | BHRZMAMKTLARKJ-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|