C26H25ClN2O3 — CID 162356692
2-[3-(4-chlorophenyl)propylimino]-3-[2-methyl-6-(4-methylphenoxy)phenyl]-3-oxopropanamide (PubChem CID 162356692) has the molecular formula C26H25ClN2O3 and a molecular weight of 448.95 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)propylimino]-3-[2-methyl-6-(4-methylphenoxy)phenyl]-3-oxopropanamide.
| Compound Name | 2-[3-(4-chlorophenyl)propylimino]-3-[2-methyl-6-(4-methylphenoxy)phenyl]-3-oxopropanamide |
|---|---|
| PubChem CID | 162356692 |
| Molecular Formula | C26H25ClN2O3 |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | 2-[3-(4-chlorophenyl)propylimino]-3-[2-methyl-6-(4-methylphenoxy)phenyl]-3-oxopropanamide |
| SMILES | Cc1ccc(Oc2cccc(C)c2C(=O)/C(=N/CCCc2ccc(Cl)cc2)C(N)=O)cc1 |
| InChI | InChI=1S/C26H25ClN2O3/c1-17-8-14-21(15-9-17)32-22-7-3-5-18(2)23(22)25(30)24(26(28)31)29-16-4-6-19-10-12-20(27)13-11-19/h3,5,7-15H,4,6,16H2,1-2H3,(H2,28,31)/b29-24- |
| InChIKey | XZXVGTKMEFNUKL-OLFWJLLRSA-N |
| XLogP | 5.49 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|