About 7-[3-(3-fluorophenyl)-2,7-dioxopyrano[3,2-c]pyridin-6-yl]heptyl 2-methylprop-2-enoate
7-[3-(3-fluorophenyl)-2,7-dioxopyrano[3,2-c]pyridin-6-yl]heptyl 2-methylprop-2-enoate (PubChem CID 162356702) has the molecular formula C25H26FNO5
and a molecular weight of 439.48 g/mol. Its IUPAC name is 7-[3-(3-fluorophenyl)-2,7-dioxopyrano[3,2-c]pyridin-6-yl]heptyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | 7-[3-(3-fluorophenyl)-2,7-dioxopyrano[3,2-c]pyridin-6-yl]heptyl 2-methylprop-2-enoate |
| PubChem CID | 162356702 |
| Molecular Formula | C25H26FNO5 |
| Molecular Weight | 439.48 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 7-[3-(3-fluorophenyl)-2,7-dioxopyrano[3,2-c]pyridin-6-yl]heptyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCCn1cc2cc(-c3cccc(F)c3)c(=O)oc2cc1=O |
| InChI | InChI=1S/C25H26FNO5/c1-17(2)24(29)31-12-7-5-3-4-6-11-27-16-19-14-21(18-9-8-10-20(26)13-18)25(30)32-22(19)15-23(27)28/h8-10,13-16H,1,3-7,11-12H2,2H3 |
| InChIKey | MUYHYYMRVCWLFB-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 78.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 439.48 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 7-[3-(3-fluorophenyl)-2,7-dioxopyrano[3,2-c]pyridin-6-yl]heptyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[3-(3-fluorophenyl)-2,7-dioxopyrano[3,2-c]pyridin-6-yl]heptyl 2-methylprop-2-enoate?
The IUPAC name of 7-[3-(3-fluorophenyl)-2,7-dioxopyrano[3,2-c]pyridin-6-yl]heptyl 2-methylprop-2-enoate (CID 162356702) is 7-[3-(3-fluorophenyl)-2,7-dioxopyrano[3,2-c]pyridin-6-yl]heptyl 2-methylprop-2-enoate.
What is the SMILES notation for 7-[3-(3-fluorophenyl)-2,7-dioxopyrano[3,2-c]pyridin-6-yl]heptyl 2-methylprop-2-enoate?
The canonical SMILES for 7-[3-(3-fluorophenyl)-2,7-dioxopyrano[3,2-c]pyridin-6-yl]heptyl 2-methylprop-2-enoate is C=C(C)C(=O)OCCCCCCCn1cc2cc(-c3cccc(F)c3)c(=O)oc2cc1=O.
What is the InChIKey of 7-[3-(3-fluorophenyl)-2,7-dioxopyrano[3,2-c]pyridin-6-yl]heptyl 2-methylprop-2-enoate?
The InChIKey is MUYHYYMRVCWLFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H26FNO5/c1-17(2)24(29)31-12-7-5-3-4-6-11-27-16-19-14-21(18-9-8-10-20(26)13-18)25(30)32-22(19)15-23(27)28/h8-10,13-16H,1,3-7,11-12H2,2H3.
What are the key properties of 7-[3-(3-fluorophenyl)-2,7-dioxopyrano[3,2-c]pyridin-6-yl]heptyl 2-methylprop-2-enoate?
7-[3-(3-fluorophenyl)-2,7-dioxopyrano[3,2-c]pyridin-6-yl]heptyl 2-methylprop-2-enoate has a molecular weight of 439.48 g/mol, XLogP of 4.83, 10 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[3-(3-fluorophenyl)-2,7-dioxopyrano[3,2-c]pyridin-6-yl]heptyl 2-methylprop-2-enoate is sourced from PubChem (CID 162356702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).