C31H40F3NO4S — CID 162356715
methanethioic S-acid;3-[4-(11-methyltridecoxy)phenyl]-6-(2,2,2-trifluoroethyl)pyrano[2,3-b]pyridin-2-one (PubChem CID 162356715) has the molecular formula C31H40F3NO4S and a molecular weight of 579.73 g/mol. Its IUPAC name is methanethioic S-acid;3-[4-(11-methyltridecoxy)phenyl]-6-(2,2,2-trifluoroethyl)pyrano[2,3-b]pyridin-2-one.
| Compound Name | methanethioic S-acid;3-[4-(11-methyltridecoxy)phenyl]-6-(2,2,2-trifluoroethyl)pyrano[2,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 162356715 |
| Molecular Formula | C31H40F3NO4S |
| Molecular Weight | 579.73 g/mol |
| Exact Mass | 579.26 |
| IUPAC Name | methanethioic S-acid;3-[4-(11-methyltridecoxy)phenyl]-6-(2,2,2-trifluoroethyl)pyrano[2,3-b]pyridin-2-one |
| SMILES | CCC(C)CCCCCCCCCCOc1ccc(-c2cc3cc(CC(F)(F)F)cnc3oc2=O)cc1.O=CS |
| InChI | InChI=1S/C30H38F3NO3.CH2OS/c1-3-22(2)12-10-8-6-4-5-7-9-11-17-36-26-15-13-24(14-16-26)27-19-25-18-23(20-30(31,32)33)21-34-28(25)37-29(27)35;2-1-3/h13-16,18-19,21-22H,3-12,17,20H2,1-2H3;1H,(H,2,3) |
| InChIKey | CSNOMBBBGHAWHL-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.73 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|