C34H46FNO5 — CID 162356722
9-[3-(3-fluorophenyl)-2-oxopyrano[2,3-b]pyridin-5-yl]oxynonyl 2,2,3,5,5-pentamethylhexanoate (PubChem CID 162356722) has the molecular formula C34H46FNO5 and a molecular weight of 567.74 g/mol. Its IUPAC name is 9-[3-(3-fluorophenyl)-2-oxopyrano[2,3-b]pyridin-5-yl]oxynonyl 2,2,3,5,5-pentamethylhexanoate.
| Compound Name | 9-[3-(3-fluorophenyl)-2-oxopyrano[2,3-b]pyridin-5-yl]oxynonyl 2,2,3,5,5-pentamethylhexanoate |
|---|---|
| PubChem CID | 162356722 |
| Molecular Formula | C34H46FNO5 |
| Molecular Weight | 567.74 g/mol |
| Exact Mass | 567.34 |
| IUPAC Name | 9-[3-(3-fluorophenyl)-2-oxopyrano[2,3-b]pyridin-5-yl]oxynonyl 2,2,3,5,5-pentamethylhexanoate |
| SMILES | CC(CC(C)(C)C)C(C)(C)C(=O)OCCCCCCCCCOc1ccnc2oc(=O)c(-c3cccc(F)c3)cc12 |
| InChI | InChI=1S/C34H46FNO5/c1-24(23-33(2,3)4)34(5,6)32(38)40-20-13-11-9-7-8-10-12-19-39-29-17-18-36-30-28(29)22-27(31(37)41-30)25-15-14-16-26(35)21-25/h14-18,21-22,24H,7-13,19-20,23H2,1-6H3 |
| InChIKey | DPBUCIQDICBHLX-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.74 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|