C35H48F3NO8S — CID 162356724
7-[2-[2-[2-(2-methoxyethoxy)ethylsulfanyl]ethoxy]ethoxy]-3-[4-(trifluoromethoxy)phenyl]pyrano[3,2-c]pyridin-2-one;2,2,3,5,5-pentamethylhexanal (PubChem CID 162356724) has the molecular formula C35H48F3NO8S and a molecular weight of 699.83 g/mol. Its IUPAC name is 7-[2-[2-[2-(2-methoxyethoxy)ethylsulfanyl]ethoxy]ethoxy]-3-[4-(trifluoromethoxy)phenyl]pyrano[3,2-c]pyridin-2-one;2,2,3,5,5-pentamethylhexanal.
| Compound Name | 7-[2-[2-[2-(2-methoxyethoxy)ethylsulfanyl]ethoxy]ethoxy]-3-[4-(trifluoromethoxy)phenyl]pyrano[3,2-c]pyridin-2-one;2,2,3,5,5-pentamethylhexanal |
|---|---|
| PubChem CID | 162356724 |
| Molecular Formula | C35H48F3NO8S |
| Molecular Weight | 699.83 g/mol |
| Exact Mass | 699.31 |
| IUPAC Name | 7-[2-[2-[2-(2-methoxyethoxy)ethylsulfanyl]ethoxy]ethoxy]-3-[4-(trifluoromethoxy)phenyl]pyrano[3,2-c]pyridin-2-one;2,2,3,5,5-pentamethylhexanal |
| SMILES | CC(CC(C)(C)C)C(C)(C)C=O.COCCOCCSCCOCCOc1cc2oc(=O)c(-c3ccc(OC(F)(F)F)cc3)cc2cn1 |
| InChI | InChI=1S/C24H26F3NO7S.C11H22O/c1-30-6-7-31-10-12-36-13-11-32-8-9-33-22-15-21-18(16-28-22)14-20(23(29)34-21)17-2-4-19(5-3-17)35-24(25,26)27;1-9(7-10(2,3)4)11(5,6)8-12/h2-5,14-16H,6-13H2,1H3;8-9H,7H2,1-6H3 |
| InChIKey | AKHRADBEXYQZGL-UHFFFAOYSA-N |
| XLogP | 7.83 |
| TPSA | 106.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.83 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|