C36H50BrF2NO5 — CID 162356727
7-[7-(4-bromobutyl)-1,18-dihydroxyoctadecan-8-yl]oxy-3-(3,5-difluorophenyl)pyrano[2,3-b]pyridin-2-one (PubChem CID 162356727) has the molecular formula C36H50BrF2NO5 and a molecular weight of 694.70 g/mol. Its IUPAC name is 7-[7-(4-bromobutyl)-1,18-dihydroxyoctadecan-8-yl]oxy-3-(3,5-difluorophenyl)pyrano[2,3-b]pyridin-2-one.
| Compound Name | 7-[7-(4-bromobutyl)-1,18-dihydroxyoctadecan-8-yl]oxy-3-(3,5-difluorophenyl)pyrano[2,3-b]pyridin-2-one |
|---|---|
| PubChem CID | 162356727 |
| Molecular Formula | C36H50BrF2NO5 |
| Molecular Weight | 694.70 g/mol |
| Exact Mass | 693.28 |
| IUPAC Name | 7-[7-(4-bromobutyl)-1,18-dihydroxyoctadecan-8-yl]oxy-3-(3,5-difluorophenyl)pyrano[2,3-b]pyridin-2-one |
| SMILES | O=c1oc2nc(OC(CCCCCCCCCCO)C(CCCCBr)CCCCCCO)ccc2cc1-c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C36H50BrF2NO5/c37-20-12-11-16-27(15-9-6-8-14-22-42)33(17-10-5-3-1-2-4-7-13-21-41)44-34-19-18-28-25-32(36(43)45-35(28)40-34)29-23-30(38)26-31(39)24-29/h18-19,23-27,33,41-42H,1-17,20-22H2 |
| InChIKey | BDMWBESQQLTAMV-UHFFFAOYSA-N |
| XLogP | 9.51 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.70 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|