C34H44F3NO7S — CID 162356802
2-[2-[2-[2-[2,6-dioxo-3-[2-(trifluoromethyl)phenyl]pyrano[2,3-c]pyridin-7-yl]ethoxy]ethylsulfanyl]ethoxy]ethyl 2,2,3,5,5-pentamethylhexanoate (PubChem CID 162356802) has the molecular formula C34H44F3NO7S and a molecular weight of 667.79 g/mol. Its IUPAC name is 2-[2-[2-[2-[2,6-dioxo-3-[2-(trifluoromethyl)phenyl]pyrano[2,3-c]pyridin-7-yl]ethoxy]ethylsulfanyl]ethoxy]ethyl 2,2,3,5,5-pentamethylhexanoate.
| Compound Name | 2-[2-[2-[2-[2,6-dioxo-3-[2-(trifluoromethyl)phenyl]pyrano[2,3-c]pyridin-7-yl]ethoxy]ethylsulfanyl]ethoxy]ethyl 2,2,3,5,5-pentamethylhexanoate |
|---|---|
| PubChem CID | 162356802 |
| Molecular Formula | C34H44F3NO7S |
| Molecular Weight | 667.79 g/mol |
| Exact Mass | 667.28 |
| IUPAC Name | 2-[2-[2-[2-[2,6-dioxo-3-[2-(trifluoromethyl)phenyl]pyrano[2,3-c]pyridin-7-yl]ethoxy]ethylsulfanyl]ethoxy]ethyl 2,2,3,5,5-pentamethylhexanoate |
| SMILES | CC(CC(C)(C)C)C(C)(C)C(=O)OCCOCCSCCOCCn1cc2oc(=O)c(-c3ccccc3C(F)(F)F)cc2cc1=O |
| InChI | InChI=1S/C34H44F3NO7S/c1-23(21-32(2,3)4)33(5,6)31(41)44-14-13-43-16-18-46-17-15-42-12-11-38-22-28-24(20-29(38)39)19-26(30(40)45-28)25-9-7-8-10-27(25)34(35,36)37/h7-10,19-20,22-23H,11-18,21H2,1-6H3 |
| InChIKey | DJKJIMASQAWASE-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 96.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.79 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|