C19H16Cl2N6O — CID 162357232
2-[(2,4-dichlorophenyl)methylamino]-5-(2-phenylethyl)-6H-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-one (PubChem CID 162357232) has the molecular formula C19H16Cl2N6O and a molecular weight of 415.28 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methylamino]-5-(2-phenylethyl)-6H-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-one.
| Compound Name | 2-[(2,4-dichlorophenyl)methylamino]-5-(2-phenylethyl)-6H-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-one |
|---|---|
| PubChem CID | 162357232 |
| Molecular Formula | C19H16Cl2N6O |
| Molecular Weight | 415.28 g/mol |
| Exact Mass | 414.08 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methylamino]-5-(2-phenylethyl)-6H-[1,2,4]triazolo[1,5-a][1,3,5]triazin-7-one |
| SMILES | O=c1[nH]c(CCc2ccccc2)nc2nc(NCc3ccc(Cl)cc3Cl)nn12 |
| InChI | InChI=1S/C19H16Cl2N6O/c20-14-8-7-13(15(21)10-14)11-22-17-25-18-23-16(24-19(28)27(18)26-17)9-6-12-4-2-1-3-5-12/h1-5,7-8,10H,6,9,11H2,(H2,22,23,24,25,26,28) |
| InChIKey | BPCUBJKIPDWQSV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.28 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |