About methyl 5-chloro-2-(1,2-oxazole-3-carbonylamino)pyridine-4-carboxylate
methyl 5-chloro-2-(1,2-oxazole-3-carbonylamino)pyridine-4-carboxylate (PubChem CID 162357260) has the molecular formula C11H8ClN3O4
and a molecular weight of 281.66 g/mol. Its IUPAC name is methyl 5-chloro-2-(1,2-oxazole-3-carbonylamino)pyridine-4-carboxylate.
Molecular Properties
| Compound Name | methyl 5-chloro-2-(1,2-oxazole-3-carbonylamino)pyridine-4-carboxylate |
| PubChem CID | 162357260 |
| Molecular Formula | C11H8ClN3O4 |
| Molecular Weight | 281.66 g/mol |
| Exact Mass | 281.02 |
| IUPAC Name | methyl 5-chloro-2-(1,2-oxazole-3-carbonylamino)pyridine-4-carboxylate |
| SMILES | COC(=O)c1cc(NC(=O)c2ccon2)ncc1Cl |
| InChI | InChI=1S/C11H8ClN3O4/c1-18-11(17)6-4-9(13-5-7(6)12)14-10(16)8-2-3-19-15-8/h2-5H,1H3,(H,13,14,16) |
| InChIKey | IAWRWWXWOAFNKK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.66 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 5-chloro-2-(1,2-oxazole-3-carbonylamino)pyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-chloro-2-(1,2-oxazole-3-carbonylamino)pyridine-4-carboxylate?
The IUPAC name of methyl 5-chloro-2-(1,2-oxazole-3-carbonylamino)pyridine-4-carboxylate (CID 162357260) is methyl 5-chloro-2-(1,2-oxazole-3-carbonylamino)pyridine-4-carboxylate.
What is the SMILES notation for methyl 5-chloro-2-(1,2-oxazole-3-carbonylamino)pyridine-4-carboxylate?
The canonical SMILES for methyl 5-chloro-2-(1,2-oxazole-3-carbonylamino)pyridine-4-carboxylate is COC(=O)c1cc(NC(=O)c2ccon2)ncc1Cl.
What is the InChIKey of methyl 5-chloro-2-(1,2-oxazole-3-carbonylamino)pyridine-4-carboxylate?
The InChIKey is IAWRWWXWOAFNKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8ClN3O4/c1-18-11(17)6-4-9(13-5-7(6)12)14-10(16)8-2-3-19-15-8/h2-5H,1H3,(H,13,14,16).
What are the key properties of methyl 5-chloro-2-(1,2-oxazole-3-carbonylamino)pyridine-4-carboxylate?
methyl 5-chloro-2-(1,2-oxazole-3-carbonylamino)pyridine-4-carboxylate has a molecular weight of 281.66 g/mol, XLogP of 1.76, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-chloro-2-(1,2-oxazole-3-carbonylamino)pyridine-4-carboxylate is sourced from PubChem (CID 162357260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).