methyl 3-[3-(trifluoromethyl)phenoxy]quinoline-4-carboxylate

C18H12F3NO3 — CID 162357650

IUPACmethyl 3-[3-(trifluoromethyl)phenoxy]quinoline-4-carboxylate
SMILESCOC(=O)c1c(Oc2cccc(C(F)(F)F)c2)cnc2ccccc12
InChIInChI=1S/C18H12F3NO3/c1-24-17(23)16-13-7-2-3-8-14(13)22-10-15(16)25-12-6-4-5-11(9-12)18(19,20)21/h2-10H,1H3
InChIKeyUCFSDJGOAIERDY-UHFFFAOYSA-N
MW347.29 g/mol
LogP4.83
Rot. Bonds3

About methyl 3-[3-(trifluoromethyl)phenoxy]quinoline-4-carboxylate

methyl 3-[3-(trifluoromethyl)phenoxy]quinoline-4-carboxylate (PubChem CID 162357650) has the molecular formula C18H12F3NO3 and a molecular weight of 347.29 g/mol. Its IUPAC name is methyl 3-[3-(trifluoromethyl)phenoxy]quinoline-4-carboxylate.

Molecular Properties

Compound Namemethyl 3-[3-(trifluoromethyl)phenoxy]quinoline-4-carboxylate
PubChem CID162357650
Molecular FormulaC18H12F3NO3
Molecular Weight347.29 g/mol
Exact Mass347.08
IUPAC Namemethyl 3-[3-(trifluoromethyl)phenoxy]quinoline-4-carboxylate
SMILESCOC(=O)c1c(Oc2cccc(C(F)(F)F)c2)cnc2ccccc12
InChIInChI=1S/C18H12F3NO3/c1-24-17(23)16-13-7-2-3-8-14(13)22-10-15(16)25-12-6-4-5-11(9-12)18(19,20)21/h2-10H,1H3
InChIKeyUCFSDJGOAIERDY-UHFFFAOYSA-N
XLogP4.83
TPSA48.42 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms25
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500347.29
LogP ≤ 54.83
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 3-[3-(trifluoromethyl)phenoxy]quinoline-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[3-(trifluoromethyl)phenoxy]quinoline-4-carboxylate?
The IUPAC name of methyl 3-[3-(trifluoromethyl)phenoxy]quinoline-4-carboxylate (CID 162357650) is methyl 3-[3-(trifluoromethyl)phenoxy]quinoline-4-carboxylate.
What is the SMILES notation for methyl 3-[3-(trifluoromethyl)phenoxy]quinoline-4-carboxylate?
The canonical SMILES for methyl 3-[3-(trifluoromethyl)phenoxy]quinoline-4-carboxylate is COC(=O)c1c(Oc2cccc(C(F)(F)F)c2)cnc2ccccc12.
What is the InChIKey of methyl 3-[3-(trifluoromethyl)phenoxy]quinoline-4-carboxylate?
The InChIKey is UCFSDJGOAIERDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12F3NO3/c1-24-17(23)16-13-7-2-3-8-14(13)22-10-15(16)25-12-6-4-5-11(9-12)18(19,20)21/h2-10H,1H3.
What are the key properties of methyl 3-[3-(trifluoromethyl)phenoxy]quinoline-4-carboxylate?
methyl 3-[3-(trifluoromethyl)phenoxy]quinoline-4-carboxylate has a molecular weight of 347.29 g/mol, XLogP of 4.83, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[3-(trifluoromethyl)phenoxy]quinoline-4-carboxylate is sourced from PubChem (CID 162357650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).